C23H26ClN5O — CID 21450958
[5-chloro-2-[3-[1-(dimethylamino)ethyl]-5-[(prop-2-enylamino)methyl]-1,2,4-triazol-4-yl]phenyl]-phenylmethanone (PubChem CID 21450958) has the molecular formula C23H26ClN5O and a molecular weight of 423.95 g/mol. Its IUPAC name is [5-chloro-2-[3-[1-(dimethylamino)ethyl]-5-[(prop-2-enylamino)methyl]-1,2,4-triazol-4-yl]phenyl]-phenylmethanone.
| Compound Name | [5-chloro-2-[3-[1-(dimethylamino)ethyl]-5-[(prop-2-enylamino)methyl]-1,2,4-triazol-4-yl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 21450958 |
| Molecular Formula | C23H26ClN5O |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [5-chloro-2-[3-[1-(dimethylamino)ethyl]-5-[(prop-2-enylamino)methyl]-1,2,4-triazol-4-yl]phenyl]-phenylmethanone |
| SMILES | C=CCNCc1nnc(C(C)N(C)C)n1-c1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26ClN5O/c1-5-13-25-15-21-26-27-23(16(2)28(3)4)29(21)20-12-11-18(24)14-19(20)22(30)17-9-7-6-8-10-17/h5-12,14,16,25H,1,13,15H2,2-4H3 |
| InChIKey | RRJVFTZFNZRTPS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|