C17H30O6Si — CID 21465801
[1-[diacetyloxy(methyl)silyl]-2,5-dimethylhexan-3-yl] 2-methylprop-2-enoate (PubChem CID 21465801) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is [1-[diacetyloxy(methyl)silyl]-2,5-dimethylhexan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[diacetyloxy(methyl)silyl]-2,5-dimethylhexan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21465801 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [1-[diacetyloxy(methyl)silyl]-2,5-dimethylhexan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC(C)C)C(C)C[Si](C)(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H30O6Si/c1-11(2)9-16(21-17(20)12(3)4)13(5)10-24(8,22-14(6)18)23-15(7)19/h11,13,16H,3,9-10H2,1-2,4-8H3 |
| InChIKey | AFKYPGQFWOAPLA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|