C43H41ClN2O5S — CID 21474800
5-[[4-[2-[2-[(3-chlorophenoxy)methyl]morpholin-4-yl]propoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 21474800) has the molecular formula C43H41ClN2O5S and a molecular weight of 733.33 g/mol. Its IUPAC name is 5-[[4-[2-[2-[(3-chlorophenoxy)methyl]morpholin-4-yl]propoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[2-[(3-chlorophenoxy)methyl]morpholin-4-yl]propoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21474800 |
| Molecular Formula | C43H41ClN2O5S |
| Molecular Weight | 733.33 g/mol |
| Exact Mass | 732.24 |
| IUPAC Name | 5-[[4-[2-[2-[(3-chlorophenoxy)methyl]morpholin-4-yl]propoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(COc1ccc(CC2SC(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)cc1)N1CCOC(COc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C43H41ClN2O5S/c1-31(45-24-25-49-39(28-45)30-51-38-19-11-18-36(44)27-38)29-50-37-22-20-32(21-23-37)26-40-41(47)46(42(48)52-40)43(33-12-5-2-6-13-33,34-14-7-3-8-15-34)35-16-9-4-10-17-35/h2-23,27,31,39-40H,24-26,28-30H2,1H3 |
| InChIKey | VNOFTELBNRYTDV-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.33 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|