C15H16Br2N+ — CID 2192527
benzyl-bis(4-bromobuta-2,3-dienyl)azanium (PubChem CID 2192527) has the molecular formula C15H16Br2N+ and a molecular weight of 370.11 g/mol. Its IUPAC name is benzyl-bis(4-bromobuta-2,3-dienyl)azanium.
| Compound Name | benzyl-bis(4-bromobuta-2,3-dienyl)azanium |
|---|---|
| PubChem CID | 2192527 |
| Molecular Formula | C15H16Br2N+ |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | benzyl-bis(4-bromobuta-2,3-dienyl)azanium |
| SMILES | BrC=C=CC[NH+](CC=C=CBr)Cc1ccccc1 |
| InChI | InChI=1S/C15H15Br2N/c16-10-4-6-12-18(13-7-5-11-17)14-15-8-2-1-3-9-15/h1-3,6-11H,12-14H2/p+1 |
| InChIKey | RZSSZVCKPRQWTC-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |