C8H15N3O4 — CID 21953
1,2-dihydropyridazine-3,6-dione;2-(2-hydroxyethylamino)ethanol (PubChem CID 21953) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1,2-dihydropyridazine-3,6-dione;2-(2-hydroxyethylamino)ethanol.
| Compound Name | 1,2-dihydropyridazine-3,6-dione;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 21953 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1,2-dihydropyridazine-3,6-dione;2-(2-hydroxyethylamino)ethanol |
| SMILES | O=c1ccc(=O)[nH][nH]1.OCCNCCO |
| InChI | InChI=1S/C4H4N2O2.C4H11NO2/c7-3-1-2-4(8)6-5-3;6-3-1-5-2-4-7/h1-2H,(H,5,7)(H,6,8);5-7H,1-4H2 |
| InChIKey | JRIDWRXQHJJLPL-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|