C35H47F5O7S — CID 22033226
2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-6-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoic acid (PubChem CID 22033226) has the molecular formula C35H47F5O7S and a molecular weight of 706.81 g/mol. Its IUPAC name is 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-6-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoic acid.
| Compound Name | 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-6-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoic acid |
|---|---|
| PubChem CID | 22033226 |
| Molecular Formula | C35H47F5O7S |
| Molecular Weight | 706.81 g/mol |
| Exact Mass | 706.30 |
| IUPAC Name | 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-6-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoic acid |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCC(CCCCSCCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C35H47F5O7S/c1-33(26-12-14-27(15-13-26)46-23-43-2)22-45-31-21-28(47-24-44-3)16-17-29(31)30(33)11-5-4-9-25(32(41)42)10-6-7-19-48-20-8-18-34(36,37)35(38,39)40/h12-17,21,25,30H,4-11,18-20,22-24H2,1-3H3,(H,41,42) |
| InChIKey | ISHJMRGFFCLRIN-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.81 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|