C8H7N3O — CID 22051603
1,5-dihydropyrido[2,3-b][1,4]diazepin-4-one (PubChem CID 22051603) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 1,5-dihydropyrido[2,3-b][1,4]diazepin-4-one.
| Compound Name | 1,5-dihydropyrido[2,3-b][1,4]diazepin-4-one |
|---|---|
| PubChem CID | 22051603 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 1,5-dihydropyrido[2,3-b][1,4]diazepin-4-one |
| SMILES | O=C1C=CNc2cccnc2N1 |
| InChI | InChI=1S/C8H7N3O/c12-7-3-5-9-6-2-1-4-10-8(6)11-7/h1-5,9H,(H,10,11,12) |
| InChIKey | JQBOAIAQGAIKBN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |