About 4-propan-2-ylidene-1H-1,8-naphthyridine
4-propan-2-ylidene-1H-1,8-naphthyridine (PubChem CID 58770052) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-propan-2-ylidene-1H-1,8-naphthyridine.
Molecular Properties
| Compound Name | 4-propan-2-ylidene-1H-1,8-naphthyridine |
| PubChem CID | 58770052 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-propan-2-ylidene-1H-1,8-naphthyridine |
| SMILES | CC(C)=C1C=CNc2ncccc21 |
| InChI | InChI=1S/C11H12N2/c1-8(2)9-5-7-13-11-10(9)4-3-6-12-11/h3-7H,1-2H3,(H,12,13) |
| InChIKey | YCBKROJKVPIJAH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-ylidene-1H-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylidene-1H-1,8-naphthyridine?
The IUPAC name of 4-propan-2-ylidene-1H-1,8-naphthyridine (CID 58770052) is 4-propan-2-ylidene-1H-1,8-naphthyridine.
What is the SMILES notation for 4-propan-2-ylidene-1H-1,8-naphthyridine?
The canonical SMILES for 4-propan-2-ylidene-1H-1,8-naphthyridine is CC(C)=C1C=CNc2ncccc21.
What is the InChIKey of 4-propan-2-ylidene-1H-1,8-naphthyridine?
The InChIKey is YCBKROJKVPIJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-8(2)9-5-7-13-11-10(9)4-3-6-12-11/h3-7H,1-2H3,(H,12,13).
What are the key properties of 4-propan-2-ylidene-1H-1,8-naphthyridine?
4-propan-2-ylidene-1H-1,8-naphthyridine has a molecular weight of 172.23 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylidene-1H-1,8-naphthyridine is sourced from PubChem (CID 58770052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).