About 4H-pyrido[3,2-b][1,4]thiazine
4H-pyrido[3,2-b][1,4]thiazine (PubChem CID 19746111) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 4H-pyrido[3,2-b][1,4]thiazine.
Molecular Properties
| Compound Name | 4H-pyrido[3,2-b][1,4]thiazine |
| PubChem CID | 19746111 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 4H-pyrido[3,2-b][1,4]thiazine |
| SMILES | C1=CSc2cccnc2N1 |
| InChI | InChI=1S/C7H6N2S/c1-2-6-7(8-3-1)9-4-5-10-6/h1-5H,(H,8,9) |
| InChIKey | KYJONJXFUPDUFZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-pyrido[3,2-b][1,4]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrido[3,2-b][1,4]thiazine?
The IUPAC name of 4H-pyrido[3,2-b][1,4]thiazine (CID 19746111) is 4H-pyrido[3,2-b][1,4]thiazine.
What is the SMILES notation for 4H-pyrido[3,2-b][1,4]thiazine?
The canonical SMILES for 4H-pyrido[3,2-b][1,4]thiazine is C1=CSc2cccnc2N1.
What is the InChIKey of 4H-pyrido[3,2-b][1,4]thiazine?
The InChIKey is KYJONJXFUPDUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S/c1-2-6-7(8-3-1)9-4-5-10-6/h1-5H,(H,8,9).
What are the key properties of 4H-pyrido[3,2-b][1,4]thiazine?
4H-pyrido[3,2-b][1,4]thiazine has a molecular weight of 150.21 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrido[3,2-b][1,4]thiazine is sourced from PubChem (CID 19746111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).