C7H6N2S — CID 19746111
4H-pyrido[3,2-b][1,4]thiazine (PubChem CID 19746111) has the molecular formula C7H6N2S and a molecular weight of 150.21 g/mol. Its IUPAC name is 4H-pyrido[3,2-b][1,4]thiazine.
| Compound Name | 4H-pyrido[3,2-b][1,4]thiazine |
|---|---|
| PubChem CID | 19746111 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 4H-pyrido[3,2-b][1,4]thiazine |
| SMILES | C1=CSc2cccnc2N1 |
| InChI | InChI=1S/C7H6N2S/c1-2-6-7(8-3-1)9-4-5-10-6/h1-5H,(H,8,9) |
| InChIKey | KYJONJXFUPDUFZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |