C5H4IN3 — CID 142705008
7λ3-ioda-2,8,9-triazabicyclo[4.3.0]nona-1(6),2,4,7-tetraene (PubChem CID 142705008) has the molecular formula C5H4IN3 and a molecular weight of 233.01 g/mol. Its IUPAC name is 7λ3-ioda-2,8,9-triazabicyclo[4.3.0]nona-1(6),2,4,7-tetraene.
| Compound Name | 7λ3-ioda-2,8,9-triazabicyclo[4.3.0]nona-1(6),2,4,7-tetraene |
|---|---|
| PubChem CID | 142705008 |
| Molecular Formula | C5H4IN3 |
| Molecular Weight | 233.01 g/mol |
| Exact Mass | 232.94 |
| IUPAC Name | 7λ3-ioda-2,8,9-triazabicyclo[4.3.0]nona-1(6),2,4,7-tetraene |
| SMILES | c1cnc2c(c1)I=NN2 |
| InChI | InChI=1S/C5H4IN3/c1-2-4-5(7-3-1)8-9-6-4/h1-3H,(H,7,8) |
| InChIKey | XGIWPPOLXPYISN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.01 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|