C6H8IN3 — CID 89011856
2-methyl-1,3-dihydro-[1,2,5]iodadiazolo[3,4-b]pyridine (PubChem CID 89011856) has the molecular formula C6H8IN3 and a molecular weight of 249.06 g/mol. Its IUPAC name is 2-methyl-1,3-dihydro-[1,2,5]iodadiazolo[3,4-b]pyridine.
| Compound Name | 2-methyl-1,3-dihydro-[1,2,5]iodadiazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 89011856 |
| Molecular Formula | C6H8IN3 |
| Molecular Weight | 249.06 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 2-methyl-1,3-dihydro-[1,2,5]iodadiazolo[3,4-b]pyridine |
| SMILES | CI1Nc2cccnc2N1 |
| InChI | InChI=1S/C6H8IN3/c1-7-9-5-3-2-4-8-6(5)10-7/h2-4,9H,1H3,(H,8,10) |
| InChIKey | DWJYQFPBZZHDHD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|