C10H18O21S4 — CID 22052964
[2-hydroxy-5-(5-hydroxy-3,4-disulfooxyoxan-2-yl)oxy-3-sulfooxyoxan-4-yl] hydrogen sulfate (PubChem CID 22052964) has the molecular formula C10H18O21S4 and a molecular weight of 602.50 g/mol. Its IUPAC name is [2-hydroxy-5-(5-hydroxy-3,4-disulfooxyoxan-2-yl)oxy-3-sulfooxyoxan-4-yl] hydrogen sulfate.
| Compound Name | [2-hydroxy-5-(5-hydroxy-3,4-disulfooxyoxan-2-yl)oxy-3-sulfooxyoxan-4-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 22052964 |
| Molecular Formula | C10H18O21S4 |
| Molecular Weight | 602.50 g/mol |
| Exact Mass | 601.92 |
| IUPAC Name | [2-hydroxy-5-(5-hydroxy-3,4-disulfooxyoxan-2-yl)oxy-3-sulfooxyoxan-4-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)OC1C(O)COC(OC2COC(O)C(OS(=O)(=O)O)C2OS(=O)(=O)O)C1OS(=O)(=O)O |
| InChI | InChI=1S/C10H18O21S4/c11-3-1-26-10(8(31-35(22,23)24)5(3)28-32(13,14)15)27-4-2-25-9(12)7(30-34(19,20)21)6(4)29-33(16,17)18/h3-12H,1-2H2,(H,13,14,15)(H,16,17,18)(H,19,20,21)(H,22,23,24) |
| InChIKey | FCCNSUIJIOOXEZ-UHFFFAOYSA-N |
| XLogP | -4.81 |
| TPSA | 322.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.50 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|