C17H20I3NO5 — CID 22068730
5-oxohexyl 3-acetamido-5-ethoxy-2,4,6-triiodobenzoate (PubChem CID 22068730) has the molecular formula C17H20I3NO5 and a molecular weight of 699.06 g/mol. Its IUPAC name is 5-oxohexyl 3-acetamido-5-ethoxy-2,4,6-triiodobenzoate.
| Compound Name | 5-oxohexyl 3-acetamido-5-ethoxy-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 22068730 |
| Molecular Formula | C17H20I3NO5 |
| Molecular Weight | 699.06 g/mol |
| Exact Mass | 698.85 |
| IUPAC Name | 5-oxohexyl 3-acetamido-5-ethoxy-2,4,6-triiodobenzoate |
| SMILES | CCOc1c(I)c(NC(C)=O)c(I)c(C(=O)OCCCCC(C)=O)c1I |
| InChI | InChI=1S/C17H20I3NO5/c1-4-25-16-13(19)11(12(18)15(14(16)20)21-10(3)23)17(24)26-8-6-5-7-9(2)22/h4-8H2,1-3H3,(H,21,23) |
| InChIKey | PSDGTZCHSGRTDT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|