C13H18O2 — CID 22073003
cyclohexyl-(1-hydroxycyclohexa-2,4-dien-1-yl)methanone (PubChem CID 22073003) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is cyclohexyl-(1-hydroxycyclohexa-2,4-dien-1-yl)methanone.
| Compound Name | cyclohexyl-(1-hydroxycyclohexa-2,4-dien-1-yl)methanone |
|---|---|
| PubChem CID | 22073003 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | cyclohexyl-(1-hydroxycyclohexa-2,4-dien-1-yl)methanone |
| SMILES | O=C(C1CCCCC1)C1(O)C=CC=CC1 |
| InChI | InChI=1S/C13H18O2/c14-12(11-7-3-1-4-8-11)13(15)9-5-2-6-10-13/h2,5-6,9,11,15H,1,3-4,7-8,10H2 |
| InChIKey | SUGNQLYDZCBGRD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |