C28H34F8O — CID 22080351
1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethynyl]benzene (PubChem CID 22080351) has the molecular formula C28H34F8O and a molecular weight of 538.56 g/mol. Its IUPAC name is 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethynyl]benzene.
| Compound Name | 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethynyl]benzene |
|---|---|
| PubChem CID | 22080351 |
| Molecular Formula | C28H34F8O |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethynyl]benzene |
| SMILES | CCCCCC1CCC(C2CCC(C#Cc3cc(F)c(OC(F)(F)C(F)C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H34F8O/c1-2-3-4-5-18-8-12-21(13-9-18)22-14-10-19(11-15-22)6-7-20-16-23(29)25(24(30)17-20)37-28(35,36)26(31)27(32,33)34/h16-19,21-22,26H,2-5,8-15H2,1H3 |
| InChIKey | QNVZDLLIGYNZGY-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|