C19H24N4O5 — CID 22086648
[2-[(E)-(diaminomethylhydrazinylidene)methyl]phenyl] 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 22086648) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is [2-[(E)-(diaminomethylhydrazinylidene)methyl]phenyl] 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | [2-[(E)-(diaminomethylhydrazinylidene)methyl]phenyl] 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 22086648 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [2-[(E)-(diaminomethylhydrazinylidene)methyl]phenyl] 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)Oc2ccccc2/C=N/NC(N)N)cc(OC)c1OC |
| InChI | InChI=1S/C19H24N4O5/c1-25-15-8-12(9-16(26-2)18(15)27-3)10-17(24)28-14-7-5-4-6-13(14)11-22-23-19(20)21/h4-9,11,19,23H,10,20-21H2,1-3H3/b22-11+ |
| InChIKey | YKZAPWVPFVBXFU-SSDVNMTOSA-N |
| XLogP | 0.99 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|