C40H57N9O14 — CID 22088378
tert-butyl N-[[5-[bis[2-[[5-[[3-hydroxy-4-(hydroxycarbamoyl)phenyl]methylamino]-5-oxopentanoyl]amino]ethyl]amino]-5-oxopentanoyl]amino]carbamate (PubChem CID 22088378) has the molecular formula C40H57N9O14 and a molecular weight of 887.94 g/mol. Its IUPAC name is tert-butyl N-[[5-[bis[2-[[5-[[3-hydroxy-4-(hydroxycarbamoyl)phenyl]methylamino]-5-oxopentanoyl]amino]ethyl]amino]-5-oxopentanoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[5-[bis[2-[[5-[[3-hydroxy-4-(hydroxycarbamoyl)phenyl]methylamino]-5-oxopentanoyl]amino]ethyl]amino]-5-oxopentanoyl]amino]carbamate |
|---|---|
| PubChem CID | 22088378 |
| Molecular Formula | C40H57N9O14 |
| Molecular Weight | 887.94 g/mol |
| Exact Mass | 887.40 |
| IUPAC Name | tert-butyl N-[[5-[bis[2-[[5-[[3-hydroxy-4-(hydroxycarbamoyl)phenyl]methylamino]-5-oxopentanoyl]amino]ethyl]amino]-5-oxopentanoyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)CCCC(=O)N(CCNC(=O)CCCC(=O)NCc1ccc(C(=O)NO)c(O)c1)CCNC(=O)CCCC(=O)NCc1ccc(C(=O)NO)c(O)c1 |
| InChI | InChI=1S/C40H57N9O14/c1-40(2,3)63-39(60)46-45-35(56)11-6-12-36(57)49(19-17-41-31(52)7-4-9-33(54)43-23-25-13-15-27(29(50)21-25)37(58)47-61)20-18-42-32(53)8-5-10-34(55)44-24-26-14-16-28(30(51)22-26)38(59)48-62/h13-16,21-22,50-51,61-62H,4-12,17-20,23-24H2,1-3H3,(H,41,52)(H,42,53)(H,43,54)(H,44,55)(H,45,56)(H,46,60)(H,47,58)(H,48,59) |
| InChIKey | FXGHJZYDIVGSFN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 343.26 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.94 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|