C28H43N7O9 — CID 54212006
N-[2-[(5-hydrazinyl-5-oxopentanoyl)-[2-(5-oxohexanoylamino)ethyl]amino]ethyl]-N'-[[3-hydroxy-4-(hydroxycarbamoyl)phenyl]methyl]pentanediamide (PubChem CID 54212006) has the molecular formula C28H43N7O9 and a molecular weight of 621.69 g/mol. Its IUPAC name is N-[2-[(5-hydrazinyl-5-oxopentanoyl)-[2-(5-oxohexanoylamino)ethyl]amino]ethyl]-N'-[[3-hydroxy-4-(hydroxycarbamoyl)phenyl]methyl]pentanediamide.
| Compound Name | N-[2-[(5-hydrazinyl-5-oxopentanoyl)-[2-(5-oxohexanoylamino)ethyl]amino]ethyl]-N'-[[3-hydroxy-4-(hydroxycarbamoyl)phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 54212006 |
| Molecular Formula | C28H43N7O9 |
| Molecular Weight | 621.69 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | N-[2-[(5-hydrazinyl-5-oxopentanoyl)-[2-(5-oxohexanoylamino)ethyl]amino]ethyl]-N'-[[3-hydroxy-4-(hydroxycarbamoyl)phenyl]methyl]pentanediamide |
| SMILES | CC(=O)CCCC(=O)NCCN(CCNC(=O)CCCC(=O)NCc1ccc(C(=O)NO)c(O)c1)C(=O)CCCC(=O)NN |
| InChI | InChI=1S/C28H43N7O9/c1-19(36)5-2-6-23(38)30-13-15-35(27(42)10-4-9-26(41)33-29)16-14-31-24(39)7-3-8-25(40)32-18-20-11-12-21(22(37)17-20)28(43)34-44/h11-12,17,37,44H,2-10,13-16,18,29H2,1H3,(H,30,38)(H,31,39)(H,32,40)(H,33,41)(H,34,43) |
| InChIKey | PWOLLQXADBYHIB-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 249.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.69 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|