C24H28N2O5 — CID 22089989
[N-methyl-4-[[4-[methyl(prop-2-enoyloxymethyl)amino]phenyl]methoxymethyl]anilino]methyl prop-2-enoate (PubChem CID 22089989) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is [N-methyl-4-[[4-[methyl(prop-2-enoyloxymethyl)amino]phenyl]methoxymethyl]anilino]methyl prop-2-enoate.
| Compound Name | [N-methyl-4-[[4-[methyl(prop-2-enoyloxymethyl)amino]phenyl]methoxymethyl]anilino]methyl prop-2-enoate |
|---|---|
| PubChem CID | 22089989 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [N-methyl-4-[[4-[methyl(prop-2-enoyloxymethyl)amino]phenyl]methoxymethyl]anilino]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCN(C)c1ccc(COCc2ccc(N(C)COC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O5/c1-5-23(27)30-17-25(3)21-11-7-19(8-12-21)15-29-16-20-9-13-22(14-10-20)26(4)18-31-24(28)6-2/h5-14H,1-2,15-18H2,3-4H3 |
| InChIKey | HBHZILOKNCUBQL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|