C21H19N9O5 — CID 22102794
4-carbamimidoyl-2-[[2-[3-(diaminomethylideneamino)phenoxy]-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]benzoic acid (PubChem CID 22102794) has the molecular formula C21H19N9O5 and a molecular weight of 477.44 g/mol. Its IUPAC name is 4-carbamimidoyl-2-[[2-[3-(diaminomethylideneamino)phenoxy]-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]benzoic acid.
| Compound Name | 4-carbamimidoyl-2-[[2-[3-(diaminomethylideneamino)phenoxy]-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 22102794 |
| Molecular Formula | C21H19N9O5 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-carbamimidoyl-2-[[2-[3-(diaminomethylideneamino)phenoxy]-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)O)c(Oc2nc(Oc3cccc(N=C(N)N)c3)nc3c2NC(=O)CN3)c1 |
| InChI | InChI=1S/C21H19N9O5/c22-16(23)9-4-5-12(19(32)33)13(6-9)35-18-15-17(26-8-14(31)28-15)29-21(30-18)34-11-3-1-2-10(7-11)27-20(24)25/h1-7H,8H2,(H3,22,23)(H,28,31)(H,32,33)(H4,24,25,27)(H,26,29,30) |
| InChIKey | BYXHDWXEJSYHQE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 236.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|