C27H14F12N2O4 — CID 22121626
2-amino-5-[4-[1-[4-(4-amino-2,3,6-trifluoro-5-hydroxyphenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]-3,4,6-trifluorophenol (PubChem CID 22121626) has the molecular formula C27H14F12N2O4 and a molecular weight of 658.39 g/mol. Its IUPAC name is 2-amino-5-[4-[1-[4-(4-amino-2,3,6-trifluoro-5-hydroxyphenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]-3,4,6-trifluorophenol.
| Compound Name | 2-amino-5-[4-[1-[4-(4-amino-2,3,6-trifluoro-5-hydroxyphenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]-3,4,6-trifluorophenol |
|---|---|
| PubChem CID | 22121626 |
| Molecular Formula | C27H14F12N2O4 |
| Molecular Weight | 658.39 g/mol |
| Exact Mass | 658.08 |
| IUPAC Name | 2-amino-5-[4-[1-[4-(4-amino-2,3,6-trifluoro-5-hydroxyphenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]-3,4,6-trifluorophenol |
| SMILES | Nc1c(O)c(F)c(Oc2ccc(C(F)(c3ccc(Oc4c(F)c(O)c(N)c(F)c4F)cc3)C(F)(F)C(F)(F)F)cc2)c(F)c1F |
| InChI | InChI=1S/C27H14F12N2O4/c28-13-15(30)23(17(32)21(42)19(13)40)44-11-5-1-9(2-6-11)25(34,26(35,36)27(37,38)39)10-3-7-12(8-4-10)45-24-16(31)14(29)20(41)22(43)18(24)33/h1-8,42-43H,40-41H2 |
| InChIKey | FTOZDQXLXHCIEB-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.39 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|