C37H20N2O5 — CID 22160748
1-[4-[3-[7-[4-(2,5-dioxopyrrol-1-yl)phenyl]bicyclo[4.2.0]octa-1(6),2,4,7-tetraene-3-carbonyl]-7-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl]phenyl]pyrrole-2,5-dione (PubChem CID 22160748) has the molecular formula C37H20N2O5 and a molecular weight of 572.58 g/mol. Its IUPAC name is 1-[4-[3-[7-[4-(2,5-dioxopyrrol-1-yl)phenyl]bicyclo[4.2.0]octa-1(6),2,4,7-tetraene-3-carbonyl]-7-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[3-[7-[4-(2,5-dioxopyrrol-1-yl)phenyl]bicyclo[4.2.0]octa-1(6),2,4,7-tetraene-3-carbonyl]-7-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22160748 |
| Molecular Formula | C37H20N2O5 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 1-[4-[3-[7-[4-(2,5-dioxopyrrol-1-yl)phenyl]bicyclo[4.2.0]octa-1(6),2,4,7-tetraene-3-carbonyl]-7-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C(c1ccc2c(c1)C=C2c1ccc(N2C(=O)C=CC2=O)cc1)c1ccc2c(c1)C=C2c1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C37H20N2O5/c40-33-13-14-34(41)38(33)27-7-1-21(2-8-27)31-19-25-17-23(5-11-29(25)31)37(44)24-6-12-30-26(18-24)20-32(30)22-3-9-28(10-4-22)39-35(42)15-16-36(39)43/h1-20H |
| InChIKey | UCDPYXZCRYPHJX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|