C16H15O2S- — CID 22173973
2-ethylsulfanyl-2,2-diphenylacetate (PubChem CID 22173973) has the molecular formula C16H15O2S- and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-ethylsulfanyl-2,2-diphenylacetate.
| Compound Name | 2-ethylsulfanyl-2,2-diphenylacetate |
|---|---|
| PubChem CID | 22173973 |
| Molecular Formula | C16H15O2S- |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-ethylsulfanyl-2,2-diphenylacetate |
| SMILES | CCSC(C(=O)[O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O2S/c1-2-19-16(15(17)18,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H,17,18)/p-1 |
| InChIKey | NGHYFCDORXGZOD-UHFFFAOYSA-M |
| XLogP | 2.43 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |