C15H18N4O6 — CID 22213771
dimethyl (1R,5R,6S)-5-(2-methoxycarbonylhydrazinyl)-3,4-diazatricyclo[4.4.1.01,6]undeca-2,7,9-triene-2,5-dicarboxylate (PubChem CID 22213771) has the molecular formula C15H18N4O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is dimethyl (1R,5R,6S)-5-(2-methoxycarbonylhydrazinyl)-3,4-diazatricyclo[4.4.1.01,6]undeca-2,7,9-triene-2,5-dicarboxylate.
| Compound Name | dimethyl (1R,5R,6S)-5-(2-methoxycarbonylhydrazinyl)-3,4-diazatricyclo[4.4.1.01,6]undeca-2,7,9-triene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 22213771 |
| Molecular Formula | C15H18N4O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | dimethyl (1R,5R,6S)-5-(2-methoxycarbonylhydrazinyl)-3,4-diazatricyclo[4.4.1.01,6]undeca-2,7,9-triene-2,5-dicarboxylate |
| SMILES | COC(=O)NN[C@@]1(C(=O)OC)NN=C(C(=O)OC)[C@]23C=CC=C[C@]12C3 |
| InChI | InChI=1S/C15H18N4O6/c1-23-10(20)9-13-6-4-5-7-14(13,8-13)15(18-16-9,11(21)24-2)19-17-12(22)25-3/h4-7,18-19H,8H2,1-3H3,(H,17,22)/t13-,14-,15-/m1/s1 |
| InChIKey | LIAAHXUALJBZHF-RBSFLKMASA-N |
| XLogP | -0.65 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|