C37H41F2NO3 — CID 22237492
3,5-bis(4-fluoro-3-methylphenyl)-4-(2-hydroxyethoxy)-N-(8-phenyloctyl)benzamide (PubChem CID 22237492) has the molecular formula C37H41F2NO3 and a molecular weight of 585.74 g/mol. Its IUPAC name is 3,5-bis(4-fluoro-3-methylphenyl)-4-(2-hydroxyethoxy)-N-(8-phenyloctyl)benzamide.
| Compound Name | 3,5-bis(4-fluoro-3-methylphenyl)-4-(2-hydroxyethoxy)-N-(8-phenyloctyl)benzamide |
|---|---|
| PubChem CID | 22237492 |
| Molecular Formula | C37H41F2NO3 |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | 3,5-bis(4-fluoro-3-methylphenyl)-4-(2-hydroxyethoxy)-N-(8-phenyloctyl)benzamide |
| SMILES | Cc1cc(-c2cc(C(=O)NCCCCCCCCc3ccccc3)cc(-c3ccc(F)c(C)c3)c2OCCO)ccc1F |
| InChI | InChI=1S/C37H41F2NO3/c1-26-22-29(15-17-34(26)38)32-24-31(25-33(36(32)43-21-20-41)30-16-18-35(39)27(2)23-30)37(42)40-19-11-6-4-3-5-8-12-28-13-9-7-10-14-28/h7,9-10,13-18,22-25,41H,3-6,8,11-12,19-21H2,1-2H3,(H,40,42) |
| InChIKey | KMFUCXSMRVCHHQ-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|