C41H38F6N2O5 — CID 139915404
4-[2-[(2-hydroxy-3,4-dioxocyclobuten-1-yl)amino]ethoxy]-N-(8-phenyloctyl)-3,5-bis[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 139915404) has the molecular formula C41H38F6N2O5 and a molecular weight of 752.75 g/mol. Its IUPAC name is 4-[2-[(2-hydroxy-3,4-dioxocyclobuten-1-yl)amino]ethoxy]-N-(8-phenyloctyl)-3,5-bis[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[2-[(2-hydroxy-3,4-dioxocyclobuten-1-yl)amino]ethoxy]-N-(8-phenyloctyl)-3,5-bis[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 139915404 |
| Molecular Formula | C41H38F6N2O5 |
| Molecular Weight | 752.75 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | 4-[2-[(2-hydroxy-3,4-dioxocyclobuten-1-yl)amino]ethoxy]-N-(8-phenyloctyl)-3,5-bis[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(NCCCCCCCCc1ccccc1)c1cc(-c2cccc(C(F)(F)F)c2)c(OCCNc2c(O)c(=O)c2=O)c(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C41H38F6N2O5/c42-40(43,44)30-17-10-15-27(22-30)32-24-29(39(53)49-19-9-4-2-1-3-6-12-26-13-7-5-8-14-26)25-33(28-16-11-18-31(23-28)41(45,46)47)38(32)54-21-20-48-34-35(50)37(52)36(34)51/h5,7-8,10-11,13-18,22-25,48,50H,1-4,6,9,12,19-21H2,(H,49,53) |
| InChIKey | AGEBFGIGFRNCDM-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.75 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|