C30H31F3N2O2 — CID 141017157
4-(cyanomethoxy)-N-(8-phenyloctyl)-3-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 141017157) has the molecular formula C30H31F3N2O2 and a molecular weight of 508.58 g/mol. Its IUPAC name is 4-(cyanomethoxy)-N-(8-phenyloctyl)-3-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(cyanomethoxy)-N-(8-phenyloctyl)-3-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 141017157 |
| Molecular Formula | C30H31F3N2O2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 4-(cyanomethoxy)-N-(8-phenyloctyl)-3-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | N#CCOc1ccc(C(=O)NCCCCCCCCc2ccccc2)cc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H31F3N2O2/c31-30(32,33)26-15-10-14-24(21-26)27-22-25(16-17-28(27)37-20-18-34)29(36)35-19-9-4-2-1-3-6-11-23-12-7-5-8-13-23/h5,7-8,10,12-17,21-22H,1-4,6,9,11,19-20H2,(H,35,36) |
| InChIKey | XNWNXIIKJFRUBL-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|