C35H34F3NO5 — CID 90748853
2-[3-methoxy-2-phenyl-4-(6-phenylhexylcarbamoyl)-6-[3-(trifluoromethyl)phenyl]phenoxy]acetic acid (PubChem CID 90748853) has the molecular formula C35H34F3NO5 and a molecular weight of 605.65 g/mol. Its IUPAC name is 2-[3-methoxy-2-phenyl-4-(6-phenylhexylcarbamoyl)-6-[3-(trifluoromethyl)phenyl]phenoxy]acetic acid.
| Compound Name | 2-[3-methoxy-2-phenyl-4-(6-phenylhexylcarbamoyl)-6-[3-(trifluoromethyl)phenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 90748853 |
| Molecular Formula | C35H34F3NO5 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.24 |
| IUPAC Name | 2-[3-methoxy-2-phenyl-4-(6-phenylhexylcarbamoyl)-6-[3-(trifluoromethyl)phenyl]phenoxy]acetic acid |
| SMILES | COc1c(C(=O)NCCCCCCc2ccccc2)cc(-c2cccc(C(F)(F)F)c2)c(OCC(=O)O)c1-c1ccccc1 |
| InChI | InChI=1S/C35H34F3NO5/c1-43-32-29(34(42)39-20-11-3-2-6-13-24-14-7-4-8-15-24)22-28(26-18-12-19-27(21-26)35(36,37)38)33(44-23-30(40)41)31(32)25-16-9-5-10-17-25/h4-5,7-10,12,14-19,21-22H,2-3,6,11,13,20,23H2,1H3,(H,39,42)(H,40,41) |
| InChIKey | MYGROUQUFBIGTL-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|