C43H39F6NO5 — CID 22237420
2-hydroxy-4-[[4-(8-phenyloctylcarbamoyl)-2,6-bis[3-(trifluoromethyl)phenyl]phenoxy]methyl]benzoic acid (PubChem CID 22237420) has the molecular formula C43H39F6NO5 and a molecular weight of 763.78 g/mol. Its IUPAC name is 2-hydroxy-4-[[4-(8-phenyloctylcarbamoyl)-2,6-bis[3-(trifluoromethyl)phenyl]phenoxy]methyl]benzoic acid.
| Compound Name | 2-hydroxy-4-[[4-(8-phenyloctylcarbamoyl)-2,6-bis[3-(trifluoromethyl)phenyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 22237420 |
| Molecular Formula | C43H39F6NO5 |
| Molecular Weight | 763.78 g/mol |
| Exact Mass | 763.27 |
| IUPAC Name | 2-hydroxy-4-[[4-(8-phenyloctylcarbamoyl)-2,6-bis[3-(trifluoromethyl)phenyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(NCCCCCCCCc1ccccc1)c1cc(-c2cccc(C(F)(F)F)c2)c(OCc2ccc(C(=O)O)c(O)c2)c(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C43H39F6NO5/c44-42(45,46)33-17-10-15-30(23-33)36-25-32(40(52)50-21-9-4-2-1-3-6-12-28-13-7-5-8-14-28)26-37(31-16-11-18-34(24-31)43(47,48)49)39(36)55-27-29-19-20-35(41(53)54)38(51)22-29/h5,7-8,10-11,13-20,22-26,51H,1-4,6,9,12,21,27H2,(H,50,52)(H,53,54) |
| InChIKey | ZAOUHVXLFXEUQN-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.78 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|