C37H37BrF3NO6 — CID 22237641
4-[2-[2-bromo-4-(8-phenyloctylcarbamoyl)-6-[3-(trifluoromethyl)phenyl]phenoxy]ethoxy]-2-hydroxybenzoic acid (PubChem CID 22237641) has the molecular formula C37H37BrF3NO6 and a molecular weight of 728.60 g/mol. Its IUPAC name is 4-[2-[2-bromo-4-(8-phenyloctylcarbamoyl)-6-[3-(trifluoromethyl)phenyl]phenoxy]ethoxy]-2-hydroxybenzoic acid.
| Compound Name | 4-[2-[2-bromo-4-(8-phenyloctylcarbamoyl)-6-[3-(trifluoromethyl)phenyl]phenoxy]ethoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 22237641 |
| Molecular Formula | C37H37BrF3NO6 |
| Molecular Weight | 728.60 g/mol |
| Exact Mass | 727.18 |
| IUPAC Name | 4-[2-[2-bromo-4-(8-phenyloctylcarbamoyl)-6-[3-(trifluoromethyl)phenyl]phenoxy]ethoxy]-2-hydroxybenzoic acid |
| SMILES | O=C(NCCCCCCCCc1ccccc1)c1cc(Br)c(OCCOc2ccc(C(=O)O)c(O)c2)c(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C37H37BrF3NO6/c38-32-23-27(35(44)42-18-9-4-2-1-3-6-11-25-12-7-5-8-13-25)22-31(26-14-10-15-28(21-26)37(39,40)41)34(32)48-20-19-47-29-16-17-30(36(45)46)33(43)24-29/h5,7-8,10,12-17,21-24,43H,1-4,6,9,11,18-20H2,(H,42,44)(H,45,46) |
| InChIKey | VLEXYVUMGBXGSV-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.60 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|