C43H39F6NO6 — CID 22237486
2-[4-[6-[(4-phenylmethoxyphenyl)methoxy]hexylcarbamoyl]-2,6-bis[3-(trifluoromethyl)phenyl]phenoxy]acetic acid (PubChem CID 22237486) has the molecular formula C43H39F6NO6 and a molecular weight of 779.77 g/mol. Its IUPAC name is 2-[4-[6-[(4-phenylmethoxyphenyl)methoxy]hexylcarbamoyl]-2,6-bis[3-(trifluoromethyl)phenyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[6-[(4-phenylmethoxyphenyl)methoxy]hexylcarbamoyl]-2,6-bis[3-(trifluoromethyl)phenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 22237486 |
| Molecular Formula | C43H39F6NO6 |
| Molecular Weight | 779.77 g/mol |
| Exact Mass | 779.27 |
| IUPAC Name | 2-[4-[6-[(4-phenylmethoxyphenyl)methoxy]hexylcarbamoyl]-2,6-bis[3-(trifluoromethyl)phenyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(-c2cccc(C(F)(F)F)c2)cc(C(=O)NCCCCCCOCc2ccc(OCc3ccccc3)cc2)cc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C43H39F6NO6/c44-42(45,46)34-14-8-12-31(22-34)37-24-33(25-38(40(37)56-28-39(51)52)32-13-9-15-35(23-32)43(47,48)49)41(53)50-20-6-1-2-7-21-54-26-30-16-18-36(19-17-30)55-27-29-10-4-3-5-11-29/h3-5,8-19,22-25H,1-2,6-7,20-21,26-28H2,(H,50,53)(H,51,52) |
| InChIKey | IKRMGHITQISICT-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.77 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|