C35H33Cl2F2NO4 — CID 22237699
2-[2,6-bis(3-chloro-4-fluorophenyl)-4-(8-phenyloctylcarbamoyl)phenoxy]acetic acid (PubChem CID 22237699) has the molecular formula C35H33Cl2F2NO4 and a molecular weight of 640.55 g/mol. Its IUPAC name is 2-[2,6-bis(3-chloro-4-fluorophenyl)-4-(8-phenyloctylcarbamoyl)phenoxy]acetic acid.
| Compound Name | 2-[2,6-bis(3-chloro-4-fluorophenyl)-4-(8-phenyloctylcarbamoyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 22237699 |
| Molecular Formula | C35H33Cl2F2NO4 |
| Molecular Weight | 640.55 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | 2-[2,6-bis(3-chloro-4-fluorophenyl)-4-(8-phenyloctylcarbamoyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(-c2ccc(F)c(Cl)c2)cc(C(=O)NCCCCCCCCc2ccccc2)cc1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C35H33Cl2F2NO4/c36-29-20-24(13-15-31(29)38)27-18-26(19-28(34(27)44-22-33(41)42)25-14-16-32(39)30(37)21-25)35(43)40-17-9-4-2-1-3-6-10-23-11-7-5-8-12-23/h5,7-8,11-16,18-21H,1-4,6,9-10,17,22H2,(H,40,43)(H,41,42) |
| InChIKey | IUYMKZGTLYVWJX-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.55 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|