About amino nitrite;propan-2-one
amino nitrite;propan-2-one (PubChem CID 22253428) has the molecular formula C3H8N2O3
and a molecular weight of 120.11 g/mol. Its IUPAC name is amino nitrite;propan-2-one.
Molecular Properties
| Compound Name | amino nitrite;propan-2-one |
| PubChem CID | 22253428 |
| Molecular Formula | C3H8N2O3 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | amino nitrite;propan-2-one |
| SMILES | CC(C)=O.NON=O |
| InChI | InChI=1S/C3H6O.H2N2O2/c1-3(2)4;1-4-2-3/h1-2H3;1H2 |
| InChIKey | SEKKFRQATSJTNB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino nitrite;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino nitrite;propan-2-one?
The IUPAC name of amino nitrite;propan-2-one (CID 22253428) is amino nitrite;propan-2-one.
What is the SMILES notation for amino nitrite;propan-2-one?
The canonical SMILES for amino nitrite;propan-2-one is CC(C)=O.NON=O.
What is the InChIKey of amino nitrite;propan-2-one?
The InChIKey is SEKKFRQATSJTNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.H2N2O2/c1-3(2)4;1-4-2-3/h1-2H3;1H2.
What are the key properties of amino nitrite;propan-2-one?
amino nitrite;propan-2-one has a molecular weight of 120.11 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino nitrite;propan-2-one is sourced from PubChem (CID 22253428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).