amino nitrite;propan-2-one

C3H8N2O3 — CID 22253428

IUPACamino nitrite;propan-2-one
SMILESCC(C)=O.NON=O
InChIInChI=1S/C3H6O.H2N2O2/c1-3(2)4;1-4-2-3/h1-2H3;1H2
InChIKeySEKKFRQATSJTNB-UHFFFAOYSA-N
MW120.11 g/mol
LogP0.15
Rot. Bonds1

About amino nitrite;propan-2-one

amino nitrite;propan-2-one (PubChem CID 22253428) has the molecular formula C3H8N2O3 and a molecular weight of 120.11 g/mol. Its IUPAC name is amino nitrite;propan-2-one.

Molecular Properties

Compound Nameamino nitrite;propan-2-one
PubChem CID22253428
Molecular FormulaC3H8N2O3
Molecular Weight120.11 g/mol
Exact Mass120.05
IUPAC Nameamino nitrite;propan-2-one
SMILESCC(C)=O.NON=O
InChIInChI=1S/C3H6O.H2N2O2/c1-3(2)4;1-4-2-3/h1-2H3;1H2
InChIKeySEKKFRQATSJTNB-UHFFFAOYSA-N
XLogP0.15
TPSA81.75 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500120.11
LogP ≤ 50.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino nitrite;propan-2-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino nitrite;propan-2-one?
The IUPAC name of amino nitrite;propan-2-one (CID 22253428) is amino nitrite;propan-2-one.
What is the SMILES notation for amino nitrite;propan-2-one?
The canonical SMILES for amino nitrite;propan-2-one is CC(C)=O.NON=O.
What is the InChIKey of amino nitrite;propan-2-one?
The InChIKey is SEKKFRQATSJTNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.H2N2O2/c1-3(2)4;1-4-2-3/h1-2H3;1H2.
What are the key properties of amino nitrite;propan-2-one?
amino nitrite;propan-2-one has a molecular weight of 120.11 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino nitrite;propan-2-one is sourced from PubChem (CID 22253428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).