C13H32LiO9SSi2+ — CID 22283870
lithium bis(triethoxysilyl)methanesulfonic acid (PubChem CID 22283870) has the molecular formula C13H32LiO9SSi2+ and a molecular weight of 427.57 g/mol. Its IUPAC name is lithium bis(triethoxysilyl)methanesulfonic acid.
| Compound Name | lithium bis(triethoxysilyl)methanesulfonic acid |
|---|---|
| PubChem CID | 22283870 |
| Molecular Formula | C13H32LiO9SSi2+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | lithium bis(triethoxysilyl)methanesulfonic acid |
| SMILES | CCO[Si](OCC)(OCC)C([Si](OCC)(OCC)OCC)S(=O)(=O)O.[Li+] |
| InChI | InChI=1S/C13H32O9SSi2.Li/c1-7-17-24(18-8-2,19-9-3)13(23(14,15)16)25(20-10-4,21-11-5)22-12-6;/h13H,7-12H2,1-6H3,(H,14,15,16);/q;+1 |
| InChIKey | BQQFOVLACLLOPD-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|