C20H31NO5Si — CID 22284157
2-[acetyl(phenacyl)amino]-3-[tert-butyl(dimethyl)silyl]oxybutanoic acid (PubChem CID 22284157) has the molecular formula C20H31NO5Si and a molecular weight of 393.56 g/mol. Its IUPAC name is 2-[acetyl(phenacyl)amino]-3-[tert-butyl(dimethyl)silyl]oxybutanoic acid.
| Compound Name | 2-[acetyl(phenacyl)amino]-3-[tert-butyl(dimethyl)silyl]oxybutanoic acid |
|---|---|
| PubChem CID | 22284157 |
| Molecular Formula | C20H31NO5Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-[acetyl(phenacyl)amino]-3-[tert-butyl(dimethyl)silyl]oxybutanoic acid |
| SMILES | CC(=O)N(CC(=O)c1ccccc1)C(C(=O)O)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H31NO5Si/c1-14(26-27(6,7)20(3,4)5)18(19(24)25)21(15(2)22)13-17(23)16-11-9-8-10-12-16/h8-12,14,18H,13H2,1-7H3,(H,24,25) |
| InChIKey | RTWXHVDPJMYADW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|