About 1,2-bis(2,4-ditert-butylphenyl)biphenylene
1,2-bis(2,4-ditert-butylphenyl)biphenylene (PubChem CID 22292186) has the molecular formula C40H48
and a molecular weight of 528.82 g/mol. Its IUPAC name is 1,2-bis(2,4-ditert-butylphenyl)biphenylene.
Molecular Properties
| Compound Name | 1,2-bis(2,4-ditert-butylphenyl)biphenylene |
| PubChem CID | 22292186 |
| Molecular Formula | C40H48 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | 1,2-bis(2,4-ditert-butylphenyl)biphenylene |
| SMILES | CC(C)(C)c1ccc(-c2ccc3c(c2-c2ccc(C(C)(C)C)cc2C(C)(C)C)=c2ccccc2=3)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H48/c1-37(2,3)25-17-19-28(33(23-25)39(7,8)9)31-22-21-30-27-15-13-14-16-29(27)35(30)36(31)32-20-18-26(38(4,5)6)24-34(32)40(10,11)12/h13-24H,1-12H3 |
| InChIKey | PFIQRRZEQOBIMQ-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-bis(2,4-ditert-butylphenyl)biphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(2,4-ditert-butylphenyl)biphenylene?
The IUPAC name of 1,2-bis(2,4-ditert-butylphenyl)biphenylene (CID 22292186) is 1,2-bis(2,4-ditert-butylphenyl)biphenylene.
What is the SMILES notation for 1,2-bis(2,4-ditert-butylphenyl)biphenylene?
The canonical SMILES for 1,2-bis(2,4-ditert-butylphenyl)biphenylene is CC(C)(C)c1ccc(-c2ccc3c(c2-c2ccc(C(C)(C)C)cc2C(C)(C)C)=c2ccccc2=3)c(C(C)(C)C)c1.
What is the InChIKey of 1,2-bis(2,4-ditert-butylphenyl)biphenylene?
The InChIKey is PFIQRRZEQOBIMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H48/c1-37(2,3)25-17-19-28(33(23-25)39(7,8)9)31-22-21-30-27-15-13-14-16-29(27)35(30)36(31)32-20-18-26(38(4,5)6)24-34(32)40(10,11)12/h13-24H,1-12H3.
What are the key properties of 1,2-bis(2,4-ditert-butylphenyl)biphenylene?
1,2-bis(2,4-ditert-butylphenyl)biphenylene has a molecular weight of 528.82 g/mol, XLogP of 11.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(2,4-ditert-butylphenyl)biphenylene is sourced from PubChem (CID 22292186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).