C32H42BN3O7 — CID 22336973
[3-methyl-1-[2-[[2-(3-phenylanilino)-3-(3,4,5-trimethoxyphenyl)propanoyl]amino]propanoylamino]butyl]boronic acid (PubChem CID 22336973) has the molecular formula C32H42BN3O7 and a molecular weight of 591.51 g/mol. Its IUPAC name is [3-methyl-1-[2-[[2-(3-phenylanilino)-3-(3,4,5-trimethoxyphenyl)propanoyl]amino]propanoylamino]butyl]boronic acid.
| Compound Name | [3-methyl-1-[2-[[2-(3-phenylanilino)-3-(3,4,5-trimethoxyphenyl)propanoyl]amino]propanoylamino]butyl]boronic acid |
|---|---|
| PubChem CID | 22336973 |
| Molecular Formula | C32H42BN3O7 |
| Molecular Weight | 591.51 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | [3-methyl-1-[2-[[2-(3-phenylanilino)-3-(3,4,5-trimethoxyphenyl)propanoyl]amino]propanoylamino]butyl]boronic acid |
| SMILES | COc1cc(CC(Nc2cccc(-c3ccccc3)c2)C(=O)NC(C)C(=O)NC(CC(C)C)B(O)O)cc(OC)c1OC |
| InChI | InChI=1S/C32H42BN3O7/c1-20(2)15-29(33(39)40)36-31(37)21(3)34-32(38)26(16-22-17-27(41-4)30(43-6)28(18-22)42-5)35-25-14-10-13-24(19-25)23-11-8-7-9-12-23/h7-14,17-21,26,29,35,39-40H,15-16H2,1-6H3,(H,34,38)(H,36,37) |
| InChIKey | PZFHDQKICAUUFL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 138.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|