C25H19F3N4O6 — CID 22339473
N-[5-[4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-4-(trifluoromethoxy)benzamide (PubChem CID 22339473) has the molecular formula C25H19F3N4O6 and a molecular weight of 528.44 g/mol. Its IUPAC name is N-[5-[4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[5-[4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 22339473 |
| Molecular Formula | C25H19F3N4O6 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | N-[5-[4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-4-(trifluoromethoxy)benzamide |
| SMILES | Cc1cc(-n2ncc(=O)[nH]c2=O)cc(C)c1Oc1ccc(O)c(NC(=O)c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C25H19F3N4O6/c1-13-9-16(32-24(36)31-21(34)12-29-32)10-14(2)22(13)37-18-7-8-20(33)19(11-18)30-23(35)15-3-5-17(6-4-15)38-25(26,27)28/h3-12,33H,1-2H3,(H,30,35)(H,31,34,36) |
| InChIKey | FTWOUBGJOODUNS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|