C25H20F3N5O6 — CID 22339681
1-[5-[4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 22339681) has the molecular formula C25H20F3N5O6 and a molecular weight of 543.46 g/mol. Its IUPAC name is 1-[5-[4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[5-[4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 22339681 |
| Molecular Formula | C25H20F3N5O6 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 1-[5-[4-(3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | Cc1cc(-n2ncc(=O)[nH]c2=O)cc(C)c1Oc1ccc(O)c(NC(=O)Nc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C25H20F3N5O6/c1-13-9-16(33-24(37)32-21(35)12-29-33)10-14(2)22(13)38-18-7-8-20(34)19(11-18)31-23(36)30-15-3-5-17(6-4-15)39-25(26,27)28/h3-12,34H,1-2H3,(H2,30,31,36)(H,32,35,37) |
| InChIKey | JIMPGRVPAHZGRQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 147.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|