C29H29BrN4O4S — CID 22351301
4-[N-[2-[(2-bromophenyl)sulfonylamino]ethyl]-3-methoxy-4-phenylmethoxyanilino]benzenecarboximidamide (PubChem CID 22351301) has the molecular formula C29H29BrN4O4S and a molecular weight of 609.55 g/mol. Its IUPAC name is 4-[N-[2-[(2-bromophenyl)sulfonylamino]ethyl]-3-methoxy-4-phenylmethoxyanilino]benzenecarboximidamide.
| Compound Name | 4-[N-[2-[(2-bromophenyl)sulfonylamino]ethyl]-3-methoxy-4-phenylmethoxyanilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 22351301 |
| Molecular Formula | C29H29BrN4O4S |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | 4-[N-[2-[(2-bromophenyl)sulfonylamino]ethyl]-3-methoxy-4-phenylmethoxyanilino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(CCNS(=O)(=O)c2ccccc2Br)c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H29BrN4O4S/c1-37-27-19-24(15-16-26(27)38-20-21-7-3-2-4-8-21)34(23-13-11-22(12-14-23)29(31)32)18-17-33-39(35,36)28-10-6-5-9-25(28)30/h2-16,19,33H,17-18,20H2,1H3,(H3,31,32) |
| InChIKey | NEFPIGRROIQDPS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|