C25H22ClN3O4 — CID 22409430
3-[7-chloro-1-(3-ethoxy-2-hydroxypropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409430) has the molecular formula C25H22ClN3O4 and a molecular weight of 463.92 g/mol. Its IUPAC name is 3-[7-chloro-1-(3-ethoxy-2-hydroxypropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[7-chloro-1-(3-ethoxy-2-hydroxypropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409430 |
| Molecular Formula | C25H22ClN3O4 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 3-[7-chloro-1-(3-ethoxy-2-hydroxypropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CCOCC(O)Cn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2cccc(Cl)c21 |
| InChI | InChI=1S/C25H22ClN3O4/c1-2-33-13-14(30)11-29-12-18(16-7-5-8-19(26)23(16)29)22-21(24(31)28-25(22)32)17-10-27-20-9-4-3-6-15(17)20/h3-10,12,14,27,30H,2,11,13H2,1H3,(H,28,31,32) |
| InChIKey | ZZALYFJNADQSEV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|