C22H47ClN2O7Si2 — CID 22443845
dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-trimethoxysilylpropyl)azanium;ethoxy-(3-isocyanatopropyl)-dimethylsilane;chloride (PubChem CID 22443845) has the molecular formula C22H47ClN2O7Si2 and a molecular weight of 543.25 g/mol. Its IUPAC name is dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-trimethoxysilylpropyl)azanium;ethoxy-(3-isocyanatopropyl)-dimethylsilane;chloride.
| Compound Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-trimethoxysilylpropyl)azanium;ethoxy-(3-isocyanatopropyl)-dimethylsilane;chloride |
|---|---|
| PubChem CID | 22443845 |
| Molecular Formula | C22H47ClN2O7Si2 |
| Molecular Weight | 543.25 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-trimethoxysilylpropyl)azanium;ethoxy-(3-isocyanatopropyl)-dimethylsilane;chloride |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CCC[Si](OC)(OC)OC.CCO[Si](C)(C)CCCN=C=O.[Cl-] |
| InChI | InChI=1S/C14H30NO5Si.C8H17NO2Si.ClH/c1-13(2)14(16)20-11-10-15(3,4)9-8-12-21(17-5,18-6)19-7;1-4-11-12(2,3)7-5-6-9-8-10;/h1,8-12H2,2-7H3;4-7H2,1-3H3;1H/q+1;;/p-1 |
| InChIKey | SZCCNUCLNCOYAJ-UHFFFAOYSA-M |
| XLogP | 0.41 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|