C18H21N5O3S — CID 22460082
(E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-(methylsulfamoyl)anilino]phenyl]prop-2-enamide (PubChem CID 22460082) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-(methylsulfamoyl)anilino]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-(methylsulfamoyl)anilino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 22460082 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-(methylsulfamoyl)anilino]phenyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1ccc(Nc2ccc(/C=C(\C)C(=O)N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C18H21N5O3S/c1-12(17(24)23-18(19)20)11-13-3-5-14(6-4-13)22-15-7-9-16(10-8-15)27(25,26)21-2/h3-11,21-22H,1-2H3,(H4,19,20,23,24)/b12-11+ |
| InChIKey | AFBLCMUKNDXJND-VAWYXSNFSA-N |
| XLogP | 1.54 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|