C17H14F3N3O7S — CID 22465641
N-acetyl-N-[2,3-difluoro-4-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-6-nitrophenyl]acetamide (PubChem CID 22465641) has the molecular formula C17H14F3N3O7S and a molecular weight of 461.37 g/mol. Its IUPAC name is N-acetyl-N-[2,3-difluoro-4-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-6-nitrophenyl]acetamide.
| Compound Name | N-acetyl-N-[2,3-difluoro-4-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-6-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 22465641 |
| Molecular Formula | C17H14F3N3O7S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-acetyl-N-[2,3-difluoro-4-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-6-nitrophenyl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])c(N(C(C)=O)C(C)=O)c(F)c2F)cc1F |
| InChI | InChI=1S/C17H14F3N3O7S/c1-8(24)22(9(2)25)17-12(23(26)27)7-14(15(19)16(17)20)31(28,29)21-10-4-5-13(30-3)11(18)6-10/h4-7,21H,1-3H3 |
| InChIKey | MBGDIAAXPUDULI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|