C23H28FO3- — CID 22491055
(E)-3-[3-(cyclopropylmethoxy)-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl]-2-fluorobut-2-enoate (PubChem CID 22491055) has the molecular formula C23H28FO3- and a molecular weight of 371.47 g/mol. Its IUPAC name is (E)-3-[3-(cyclopropylmethoxy)-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl]-2-fluorobut-2-enoate.
| Compound Name | (E)-3-[3-(cyclopropylmethoxy)-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl]-2-fluorobut-2-enoate |
|---|---|
| PubChem CID | 22491055 |
| Molecular Formula | C23H28FO3- |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (E)-3-[3-(cyclopropylmethoxy)-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl]-2-fluorobut-2-enoate |
| SMILES | C/C(=C(\F)C(=O)[O-])c1cc2c(cc1OCC1CC1)C(C)(C)CC=C2C(C)C |
| InChI | InChI=1S/C23H29FO3/c1-13(2)16-8-9-23(4,5)19-11-20(27-12-15-6-7-15)17(10-18(16)19)14(3)21(24)22(25)26/h8,10-11,13,15H,6-7,9,12H2,1-5H3,(H,25,26)/p-1/b21-14+ |
| InChIKey | SMXYTKPPGSJGRS-KGENOOAVSA-M |
| XLogP | 4.65 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|