C22H30N4O3S — CID 22519945
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-methyl-5,5-dioxo-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide (PubChem CID 22519945) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-methyl-5,5-dioxo-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-methyl-5,5-dioxo-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 22519945 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-methyl-5,5-dioxo-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2nn(C)c3c2CS(=O)(=O)c2ccccc2-3)C1 |
| InChI | InChI=1S/C22H30N4O3S/c1-15-11-16(2)13-26(12-15)10-6-9-23-22(27)20-18-14-30(28,29)19-8-5-4-7-17(19)21(18)25(3)24-20/h4-5,7-8,15-16H,6,9-14H2,1-3H3,(H,23,27) |
| InChIKey | USNWOBKBPCLWRC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|