C30H54O8Si — CID 22559409
(E)-15-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8,12-pentamethyl-5,16-dioxoheptadec-12-enoic acid (PubChem CID 22559409) has the molecular formula C30H54O8Si and a molecular weight of 570.84 g/mol. Its IUPAC name is (E)-15-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8,12-pentamethyl-5,16-dioxoheptadec-12-enoic acid.
| Compound Name | (E)-15-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8,12-pentamethyl-5,16-dioxoheptadec-12-enoic acid |
|---|---|
| PubChem CID | 22559409 |
| Molecular Formula | C30H54O8Si |
| Molecular Weight | 570.84 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | (E)-15-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8,12-pentamethyl-5,16-dioxoheptadec-12-enoic acid |
| SMILES | CC(=O)OC(C/C=C(\C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(CC(=O)O)O[Si](C)(C)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C30H54O8Si/c1-19(16-17-24(22(4)31)37-23(5)32)14-13-15-20(2)27(35)21(3)28(36)30(9,10)25(18-26(33)34)38-39(11,12)29(6,7)8/h16,20-21,24-25,27,35H,13-15,17-18H2,1-12H3,(H,33,34)/b19-16+ |
| InChIKey | ZCIIZUWZRBLEHX-KNTRCKAVSA-N |
| XLogP | 6.11 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.84 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|