C15H10FN7O2S2 — CID 22577400
4-fluoro-N-[5-[(7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 22577400) has the molecular formula C15H10FN7O2S2 and a molecular weight of 403.42 g/mol. Its IUPAC name is 4-fluoro-N-[5-[(7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[5-[(7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 22577400 |
| Molecular Formula | C15H10FN7O2S2 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 4-fluoro-N-[5-[(7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(SCc2cc(=O)n3[nH]cnc3n2)s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10FN7O2S2/c16-9-3-1-8(2-4-9)12(25)20-14-21-22-15(27-14)26-6-10-5-11(24)23-13(19-10)17-7-18-23/h1-5,7H,6H2,(H,17,18,19)(H,20,21,25) |
| InChIKey | OSQNSCSKDHEJII-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|