C11H17ClN2 — CID 22593136
2-(3-methylbut-2-en-2-yl)benzene-1,4-diamine;hydrochloride (PubChem CID 22593136) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 2-(3-methylbut-2-en-2-yl)benzene-1,4-diamine;hydrochloride.
| Compound Name | 2-(3-methylbut-2-en-2-yl)benzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 22593136 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-(3-methylbut-2-en-2-yl)benzene-1,4-diamine;hydrochloride |
| SMILES | CC(C)=C(C)c1cc(N)ccc1N.Cl |
| InChI | InChI=1S/C11H16N2.ClH/c1-7(2)8(3)10-6-9(12)4-5-11(10)13;/h4-6H,12-13H2,1-3H3;1H |
| InChIKey | MZBCBNGKTCIYGG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|