C12H10O5S — CID 22601018
3-(2,3-dihydroxyphenyl)sulfinylbenzene-1,2-diol (PubChem CID 22601018) has the molecular formula C12H10O5S and a molecular weight of 266.27 g/mol. Its IUPAC name is 3-(2,3-dihydroxyphenyl)sulfinylbenzene-1,2-diol.
| Compound Name | 3-(2,3-dihydroxyphenyl)sulfinylbenzene-1,2-diol |
|---|---|
| PubChem CID | 22601018 |
| Molecular Formula | C12H10O5S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 3-(2,3-dihydroxyphenyl)sulfinylbenzene-1,2-diol |
| SMILES | O=S(c1cccc(O)c1O)c1cccc(O)c1O |
| InChI | InChI=1S/C12H10O5S/c13-7-3-1-5-9(11(7)15)18(17)10-6-2-4-8(14)12(10)16/h1-6,13-16H |
| InChIKey | RVEHNWVLSRVXTI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|